C33H46N2 — CID 90670990
(1R,2R,4R)-1,7,7-trimethyl-N-[4-[[4-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]phenyl]methyl]phenyl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 90670990) has the molecular formula C33H46N2 and a molecular weight of 470.75 g/mol. Its IUPAC name is (1R,2R,4R)-1,7,7-trimethyl-N-[4-[[4-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]phenyl]methyl]phenyl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4R)-1,7,7-trimethyl-N-[4-[[4-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]phenyl]methyl]phenyl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 90670990 |
| Molecular Formula | C33H46N2 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.37 |
| IUPAC Name | (1R,2R,4R)-1,7,7-trimethyl-N-[4-[[4-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]phenyl]methyl]phenyl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](Nc1ccc(Cc3ccc(N[C@@H]4C[C@H]5CC[C@]4(C)C5(C)C)cc3)cc1)C2 |
| InChI | InChI=1S/C33H46N2/c1-30(2)24-15-17-32(30,5)28(20-24)34-26-11-7-22(8-12-26)19-23-9-13-27(14-10-23)35-29-21-25-16-18-33(29,6)31(25,3)4/h7-14,24-25,28-29,34-35H,15-21H2,1-6H3/t24-,25-,28-,29-,32+,33+/m1/s1 |
| InChIKey | LECHPJWTXQSKKQ-OIRDVLARSA-N |
| XLogP | 8.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|