About 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol
3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol (PubChem CID 90671033) has the molecular formula C17H30BNO4
and a molecular weight of 323.24 g/mol. Its IUPAC name is 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol |
| PubChem CID | 90671033 |
| Molecular Formula | C17H30BNO4 |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)OB(OC(C)(C)C(C)(C)O)c1ccncc1 |
| InChI | InChI=1S/C17H30BNO4/c1-14(2,20)16(5,6)22-18(13-9-11-19-12-10-13)23-17(7,8)15(3,4)21/h9-12,20-21H,1-8H3 |
| InChIKey | HOMKTAUMEXHKLG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol?
The IUPAC name of 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol (CID 90671033) is 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol.
What is the SMILES notation for 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol?
The canonical SMILES for 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol is CC(C)(O)C(C)(C)OB(OC(C)(C)C(C)(C)O)c1ccncc1.
What is the InChIKey of 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol?
The InChIKey is HOMKTAUMEXHKLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30BNO4/c1-14(2,20)16(5,6)22-18(13-9-11-19-12-10-13)23-17(7,8)15(3,4)21/h9-12,20-21H,1-8H3.
What are the key properties of 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol?
3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol has a molecular weight of 323.24 g/mol, XLogP of 1.91, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-pyridin-4-ylboranyl]oxy-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 90671033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).