C17H29BBrNO4 — CID 90671050
3-[(6-bromo-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol (PubChem CID 90671050) has the molecular formula C17H29BBrNO4 and a molecular weight of 402.14 g/mol. Its IUPAC name is 3-[(6-bromo-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(6-bromo-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 90671050 |
| Molecular Formula | C17H29BBrNO4 |
| Molecular Weight | 402.14 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[(6-bromo-3-pyridinyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)OB(OC(C)(C)C(C)(C)O)c1ccc(Br)nc1 |
| InChI | InChI=1S/C17H29BBrNO4/c1-14(2,21)16(5,6)23-18(12-9-10-13(19)20-11-12)24-17(7,8)15(3,4)22/h9-11,21-22H,1-8H3 |
| InChIKey | WZMVFYLUNZDGMJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|