C28H23N7O5 — CID 90671098
2-amino-7,7-dimethyl-1'-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carbonitrile (PubChem CID 90671098) has the molecular formula C28H23N7O5 and a molecular weight of 537.54 g/mol. Its IUPAC name is 2-amino-7,7-dimethyl-1'-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carbonitrile.
| Compound Name | 2-amino-7,7-dimethyl-1'-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carbonitrile |
|---|---|
| PubChem CID | 90671098 |
| Molecular Formula | C28H23N7O5 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 2-amino-7,7-dimethyl-1'-[[1-(4-nitrophenyl)triazol-4-yl]methyl]-2',5-dioxospiro[6,8-dihydrochromene-4,3'-indole]-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC(N)=C(C#N)C21C(=O)N(Cc2cn(-c3ccc([N+](=O)[O-])cc3)nn2)c2ccccc21 |
| InChI | InChI=1S/C28H23N7O5/c1-27(2)11-22(36)24-23(12-27)40-25(30)20(13-29)28(24)19-5-3-4-6-21(19)33(26(28)37)14-16-15-34(32-31-16)17-7-9-18(10-8-17)35(38)39/h3-10,15H,11-12,14,30H2,1-2H3 |
| InChIKey | ASEYKNRDKUMCSO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 170.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|