C20H35BO4 — CID 90671200
3-[(4-ethylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol (PubChem CID 90671200) has the molecular formula C20H35BO4 and a molecular weight of 350.31 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(4-ethylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 90671200 |
| Molecular Formula | C20H35BO4 |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 3-[(4-ethylphenyl)-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranyl]oxy-2,3-dimethylbutan-2-ol |
| SMILES | CCc1ccc(B(OC(C)(C)C(C)(C)O)OC(C)(C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C20H35BO4/c1-10-15-11-13-16(14-12-15)21(24-19(6,7)17(2,3)22)25-20(8,9)18(4,5)23/h11-14,22-23H,10H2,1-9H3 |
| InChIKey | MWPLGDKTIGIGRS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|