C12H19BN2O4S — CID 90671204
ethyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate (PubChem CID 90671204) has the molecular formula C12H19BN2O4S and a molecular weight of 298.17 g/mol. Its IUPAC name is ethyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | ethyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 90671204 |
| Molecular Formula | C12H19BN2O4S |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | ethyl N-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1ncc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C12H19BN2O4S/c1-6-17-10(16)15-9-14-7-8(20-9)13-18-11(2,3)12(4,5)19-13/h7H,6H2,1-5H3,(H,14,15,16) |
| InChIKey | RGHUMDCIPHJUGK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|