C19H20FNO3 — CID 90671403
(3-fluoro-4-hydroxyphenyl)-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methanone (PubChem CID 90671403) has the molecular formula C19H20FNO3 and a molecular weight of 329.37 g/mol. Its IUPAC name is (3-fluoro-4-hydroxyphenyl)-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methanone.
| Compound Name | (3-fluoro-4-hydroxyphenyl)-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 90671403 |
| Molecular Formula | C19H20FNO3 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (3-fluoro-4-hydroxyphenyl)-[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methanone |
| SMILES | O=C(c1ccc(CN2CCC(O)CC2)cc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C19H20FNO3/c20-17-11-15(5-6-18(17)23)19(24)14-3-1-13(2-4-14)12-21-9-7-16(22)8-10-21/h1-6,11,16,22-23H,7-10,12H2 |
| InChIKey | KACOTQQTSDQWNO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |