C22H28N2O5 — CID 90671417
N-[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]benzamide (PubChem CID 90671417) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]benzamide.
| Compound Name | N-[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]benzamide |
|---|---|
| PubChem CID | 90671417 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[(1R,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-10-oxo-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-11-yl]benzamide |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)N(NC(=O)c3ccccc3)[C@@H]3O[C@@]4(C)CC[C@@H]1[C@@]23OO4 |
| InChI | InChI=1S/C22H28N2O5/c1-13-9-10-17-14(2)19(26)24(23-18(25)15-7-5-4-6-8-15)20-22(17)16(13)11-12-21(3,27-20)28-29-22/h4-8,13-14,16-17,20H,9-12H2,1-3H3,(H,23,25)/t13-,14-,16+,17+,20-,21-,22-/m1/s1 |
| InChIKey | NRPYGKSGGCUWSF-CMWFBBTJSA-N |
| XLogP | 3.03 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|