C19H31F3N4O6 — CID 90671618
(3R,4R,5S)-4-acetamido-5-[(N'-ethylcarbamimidoyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 90671618) has the molecular formula C19H31F3N4O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-[(N'-ethylcarbamimidoyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-[(N'-ethylcarbamimidoyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90671618 |
| Molecular Formula | C19H31F3N4O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-[(N'-ethylcarbamimidoyl)amino]-3-pentan-3-yloxycyclohexene-1-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC/N=C(\N)N[C@H]1CC(C(=O)O)=C[C@@H](OC(CC)CC)[C@@H]1NC(C)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H30N4O4.C2HF3O2/c1-5-12(6-2)25-14-9-11(16(23)24)8-13(15(14)20-10(4)22)21-17(18)19-7-3;3-2(4,5)1(6)7/h9,12-15H,5-8H2,1-4H3,(H,20,22)(H,23,24)(H3,18,19,21);(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | AYWFNXJBNWBDTA-ONAKXNSWSA-N |
| XLogP | 1.41 |
| TPSA | 163.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|