C18H15NO2 — CID 90671759
2-methyl-1,2,3,4-tetrahydrobenzo[j]phenanthridine-7,12-dione (PubChem CID 90671759) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-methyl-1,2,3,4-tetrahydrobenzo[j]phenanthridine-7,12-dione.
| Compound Name | 2-methyl-1,2,3,4-tetrahydrobenzo[j]phenanthridine-7,12-dione |
|---|---|
| PubChem CID | 90671759 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-methyl-1,2,3,4-tetrahydrobenzo[j]phenanthridine-7,12-dione |
| SMILES | CC1CCc2ncc3c(c2C1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C18H15NO2/c1-10-6-7-15-13(8-10)16-14(9-19-15)17(20)11-4-2-3-5-12(11)18(16)21/h2-5,9-10H,6-8H2,1H3 |
| InChIKey | XSZWSMIBHRPDSV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|