C22H20O2 — CID 90671937
(5R,6S)-5-(4-hydroxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 90671937) has the molecular formula C22H20O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is (5R,6S)-5-(4-hydroxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (5R,6S)-5-(4-hydroxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 90671937 |
| Molecular Formula | C22H20O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (5R,6S)-5-(4-hydroxyphenyl)-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | Oc1ccc([C@@H]2c3ccc(O)cc3CC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O2/c23-18-9-6-16(7-10-18)22-20(15-4-2-1-3-5-15)12-8-17-14-19(24)11-13-21(17)22/h1-7,9-11,13-14,20,22-24H,8,12H2/t20-,22+/m1/s1 |
| InChIKey | AQRJVZJHYJLAEV-IRLDBZIGSA-N |
| XLogP | 4.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |