C25H30N6O5 — CID 90672041
diethyl (2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methylamino]benzoyl]amino]pentanedioate (PubChem CID 90672041) has the molecular formula C25H30N6O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is diethyl (2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methylamino]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methylamino]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 90672041 |
| Molecular Formula | C25H30N6O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | diethyl (2S)-2-[[4-[(2,4-diaminoquinazolin-6-yl)methylamino]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(NCc2ccc3nc(N)nc(N)c3c2)cc1)C(=O)OCC |
| InChI | InChI=1S/C25H30N6O5/c1-3-35-21(32)12-11-20(24(34)36-4-2)29-23(33)16-6-8-17(9-7-16)28-14-15-5-10-19-18(13-15)22(26)31-25(27)30-19/h5-10,13,20,28H,3-4,11-12,14H2,1-2H3,(H,29,33)(H4,26,27,30,31)/t20-/m0/s1 |
| InChIKey | LPCYHYYLOMBMSO-FQEVSTJZSA-N |
| XLogP | 2.41 |
| TPSA | 171.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |