C22H24N2 — CID 90672157
(5aS,6aR,9R)-7-methyl-9-(4-methylphenyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 90672157) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (5aS,6aR,9R)-7-methyl-9-(4-methylphenyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (5aS,6aR,9R)-7-methyl-9-(4-methylphenyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 90672157 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (5aS,6aR,9R)-7-methyl-9-(4-methylphenyl)-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | Cc1ccc([C@H]2C=C3c4cccc5c4[C@@H](CN5)C[C@H]3N(C)C2)cc1 |
| InChI | InChI=1S/C22H24N2/c1-14-6-8-15(9-7-14)17-10-19-18-4-3-5-20-22(18)16(12-23-20)11-21(19)24(2)13-17/h3-10,16-17,21,23H,11-13H2,1-2H3/t16-,17+,21-/m1/s1 |
| InChIKey | CXHSJWYXLQDHRT-LLGFUMIMSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |