C21H22N2 — CID 90672159
(5aS,6aR,9R)-7-methyl-9-phenyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline (PubChem CID 90672159) has the molecular formula C21H22N2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (5aS,6aR,9R)-7-methyl-9-phenyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline.
| Compound Name | (5aS,6aR,9R)-7-methyl-9-phenyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
|---|---|
| PubChem CID | 90672159 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (5aS,6aR,9R)-7-methyl-9-phenyl-5,5a,6,6a,8,9-hexahydro-4H-indolo[4,3-fg]quinoline |
| SMILES | CN1C[C@@H](c2ccccc2)C=C2c3cccc4c3[C@@H](CN4)C[C@H]21 |
| InChI | InChI=1S/C21H22N2/c1-23-13-16(14-6-3-2-4-7-14)10-18-17-8-5-9-19-21(17)15(12-22-19)11-20(18)23/h2-10,15-16,20,22H,11-13H2,1H3/t15-,16+,20-/m1/s1 |
| InChIKey | GXDYSBPEAUPTNF-GQIGUUNPSA-N |
| XLogP | 4.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |