C16H9NO5S — CID 90672229
1,11,11-trioxo-4H-[1]benzothiolo[2,3-f]quinoline-3-carboxylic acid (PubChem CID 90672229) has the molecular formula C16H9NO5S and a molecular weight of 327.32 g/mol. Its IUPAC name is 1,11,11-trioxo-4H-[1]benzothiolo[2,3-f]quinoline-3-carboxylic acid.
| Compound Name | 1,11,11-trioxo-4H-[1]benzothiolo[2,3-f]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 90672229 |
| Molecular Formula | C16H9NO5S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 1,11,11-trioxo-4H-[1]benzothiolo[2,3-f]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2c3c(ccc2[nH]1)-c1ccccc1S3(=O)=O |
| InChI | InChI=1S/C16H9NO5S/c18-12-7-11(16(19)20)17-10-6-5-9-8-3-1-2-4-13(8)23(21,22)15(9)14(10)12/h1-7H,(H,17,18)(H,19,20) |
| InChIKey | KLXDGFDGNPNBHZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |