C12H16O8S — CID 90672356
[(2S,3S,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl benzenesulfonate (PubChem CID 90672356) has the molecular formula C12H16O8S and a molecular weight of 320.32 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl benzenesulfonate.
| Compound Name | [(2S,3S,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl benzenesulfonate |
|---|---|
| PubChem CID | 90672356 |
| Molecular Formula | C12H16O8S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | [(2S,3S,4R,5S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl benzenesulfonate |
| SMILES | O=S(=O)(OC[C@@H]1OC(O)[C@@H](O)[C@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C12H16O8S/c13-9-8(20-12(16)11(15)10(9)14)6-19-21(17,18)7-4-2-1-3-5-7/h1-5,8-16H,6H2/t8-,9+,10+,11-,12?/m0/s1 |
| InChIKey | FIWMXPVBLOPKFA-LJBAMUFTSA-N |
| XLogP | -1.81 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|