C14H18F2O9 — CID 90672364
[(2S,3S,4R,5S,6R)-2,3,5-triacetyloxy-6-(difluoromethyl)oxan-4-yl] acetate (PubChem CID 90672364) has the molecular formula C14H18F2O9 and a molecular weight of 368.29 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-2,3,5-triacetyloxy-6-(difluoromethyl)oxan-4-yl] acetate.
| Compound Name | [(2S,3S,4R,5S,6R)-2,3,5-triacetyloxy-6-(difluoromethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 90672364 |
| Molecular Formula | C14H18F2O9 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-2,3,5-triacetyloxy-6-(difluoromethyl)oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@@H](C(F)F)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H18F2O9/c1-5(17)21-9-10(22-6(2)18)12(23-7(3)19)14(24-8(4)20)25-11(9)13(15)16/h9-14H,1-4H3/t9-,10+,11+,12-,14+/m0/s1 |
| InChIKey | GDIZITBKFZOIOJ-ILOGHGLZSA-N |
| XLogP | 0.33 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|