About 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride
6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride (PubChem CID 90672427) has the molecular formula C18H17ClF3NO2
and a molecular weight of 371.79 g/mol. Its IUPAC name is 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride |
| PubChem CID | 90672427 |
| Molecular Formula | C18H17ClF3NO2 |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(C(F)(F)F)c1)=NCC2.Cl |
| InChI | InChI=1S/C18H16F3NO2.ClH/c1-23-15-9-11-6-7-22-17(14(11)10-16(15)24-2)12-4-3-5-13(8-12)18(19,20)21;/h3-5,8-10H,6-7H2,1-2H3;1H |
| InChIKey | YLSHYMMIJUOJEQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride?
The IUPAC name of 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride (CID 90672427) is 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride.
What is the SMILES notation for 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride?
The canonical SMILES for 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride is COc1cc2c(cc1OC)C(c1cccc(C(F)(F)F)c1)=NCC2.Cl.
What is the InChIKey of 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride?
The InChIKey is YLSHYMMIJUOJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO2.ClH/c1-23-15-9-11-6-7-22-17(14(11)10-16(15)24-2)12-4-3-5-13(8-12)18(19,20)21;/h3-5,8-10H,6-7H2,1-2H3;1H.
What are the key properties of 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride?
6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride has a molecular weight of 371.79 g/mol, XLogP of 4.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-1-[3-(trifluoromethyl)phenyl]-3,4-dihydroisoquinoline;hydrochloride is sourced from PubChem (CID 90672427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).