C24H28ClNO — CID 90672500
(1R,6R,8R)-18-chloro-6-propan-2-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16(21),17,19-hexaen-6-ol (PubChem CID 90672500) has the molecular formula C24H28ClNO and a molecular weight of 381.95 g/mol. Its IUPAC name is (1R,6R,8R)-18-chloro-6-propan-2-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16(21),17,19-hexaen-6-ol.
| Compound Name | (1R,6R,8R)-18-chloro-6-propan-2-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16(21),17,19-hexaen-6-ol |
|---|---|
| PubChem CID | 90672500 |
| Molecular Formula | C24H28ClNO |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (1R,6R,8R)-18-chloro-6-propan-2-yl-3-azapentacyclo[11.8.1.03,8.09,22.016,21]docosa-9,11,13(22),16(21),17,19-hexaen-6-ol |
| SMILES | CC(C)[C@@]1(O)CCN2C[C@@H]3c4ccc(Cl)cc4CCc4cccc(c43)[C@H]2C1 |
| InChI | InChI=1S/C24H28ClNO/c1-15(2)24(27)10-11-26-14-21-19-9-8-18(25)12-17(19)7-6-16-4-3-5-20(23(16)21)22(26)13-24/h3-5,8-9,12,15,21-22,27H,6-7,10-11,13-14H2,1-2H3/t21-,22-,24-/m1/s1 |
| InChIKey | KTDBSUPKWTVSKK-CQOQZXRMSA-N |
| XLogP | 5.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |