About 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide
5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide (PubChem CID 90672506) has the molecular formula C7H10BrNO3
and a molecular weight of 236.06 g/mol. Its IUPAC name is 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide.
Molecular Properties
| Compound Name | 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide |
| PubChem CID | 90672506 |
| Molecular Formula | C7H10BrNO3 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide |
| SMILES | Br.CNCc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C7H9NO3.BrH/c1-8-3-5-2-6(9)7(10)4-11-5;/h2,4,8,10H,3H2,1H3;1H |
| InChIKey | CTFSCSYHVGTLQG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide?
The IUPAC name of 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide (CID 90672506) is 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide.
What is the SMILES notation for 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide?
The canonical SMILES for 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide is Br.CNCc1cc(=O)c(O)co1.
What is the InChIKey of 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide?
The InChIKey is CTFSCSYHVGTLQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3.BrH/c1-8-3-5-2-6(9)7(10)4-11-5;/h2,4,8,10H,3H2,1H3;1H.
What are the key properties of 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide?
5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide has a molecular weight of 236.06 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-(methylaminomethyl)pyran-4-one;hydrobromide is sourced from PubChem (CID 90672506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).