C23H40O4 — CID 90672522
7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-methylheptanoic acid (PubChem CID 90672522) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is 7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-methylheptanoic acid.
| Compound Name | 7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 90672522 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 7-[(1R)-2-[(E,3R)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]-2-methylheptanoic acid |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/C1CCC(=O)[C@@H]1CCCCCC(C)C(=O)O |
| InChI | InChI=1S/C23H40O4/c1-5-6-16-23(3,4)21(25)15-13-18-12-14-20(24)19(18)11-9-7-8-10-17(2)22(26)27/h13,15,17-19,21,25H,5-12,14,16H2,1-4H3,(H,26,27)/b15-13+/t17?,18?,19-,21-/m1/s1 |
| InChIKey | QIHDUYKLKYNYIR-RXDYCJMGSA-N |
| XLogP | 5.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|