C21H36O5 — CID 90672531
2-[4-[(1R)-2-[(E,3S)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid (PubChem CID 90672531) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid.
| Compound Name | 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid |
|---|---|
| PubChem CID | 90672531 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-4,4-dimethyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid |
| SMILES | CCCCC(C)(C)[C@@H](O)/C=C/C1CCC(=O)[C@@H]1CCCCOCC(=O)O |
| InChI | InChI=1S/C21H36O5/c1-4-5-13-21(2,3)19(23)12-10-16-9-11-18(22)17(16)8-6-7-14-26-15-20(24)25/h10,12,16-17,19,23H,4-9,11,13-15H2,1-3H3,(H,24,25)/b12-10+/t16?,17-,19+/m1/s1 |
| InChIKey | CVWUEAVZYKFDAH-QZIXPAHOSA-N |
| XLogP | 3.99 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|