About ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate
ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate (PubChem CID 90672546) has the molecular formula C22H38O5
and a molecular weight of 382.54 g/mol. Its IUPAC name is ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate |
| PubChem CID | 90672546 |
| Molecular Formula | C22H38O5 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate |
| SMILES | CCCCC[C@](C)(O)/C=C/C1CCC(=O)[C@@H]1CCCCOCC(=O)OCC |
| InChI | InChI=1S/C22H38O5/c1-4-6-8-14-22(3,25)15-13-18-11-12-20(23)19(18)10-7-9-16-26-17-21(24)27-5-2/h13,15,18-19,25H,4-12,14,16-17H2,1-3H3/b15-13+/t18?,19-,22+/m1/s1 |
| InChIKey | XQUMEOHUDVCAAM-CKZONLNSSA-N |
| XLogP | 4.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate?
The IUPAC name of ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate (CID 90672546) is ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate.
What is the SMILES notation for ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate?
The canonical SMILES for ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate is CCCCC[C@](C)(O)/C=C/C1CCC(=O)[C@@H]1CCCCOCC(=O)OCC.
What is the InChIKey of ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate?
The InChIKey is XQUMEOHUDVCAAM-CKZONLNSSA-N. The full InChI is InChI=1S/C22H38O5/c1-4-6-8-14-22(3,25)15-13-18-11-12-20(23)19(18)10-7-9-16-26-17-21(24)27-5-2/h13,15,18-19,25H,4-12,14,16-17H2,1-3H3/b15-13+/t18?,19-,22+/m1/s1.
What are the key properties of ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate?
ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate has a molecular weight of 382.54 g/mol, XLogP of 4.22, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetate is sourced from PubChem (CID 90672546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).