About 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid
2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid (PubChem CID 90672547) has the molecular formula C20H34O5
and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid |
| PubChem CID | 90672547 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid |
| SMILES | CCCCC[C@](C)(O)/C=C/C1CCC(=O)[C@@H]1CCCCOCC(=O)O |
| InChI | InChI=1S/C20H34O5/c1-3-4-6-12-20(2,24)13-11-16-9-10-18(21)17(16)8-5-7-14-25-15-19(22)23/h11,13,16-17,24H,3-10,12,14-15H2,1-2H3,(H,22,23)/b13-11+/t16?,17-,20+/m1/s1 |
| InChIKey | IXVUMDZQWOPTHA-ZDRSVHKKSA-N |
| XLogP | 3.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid?
The IUPAC name of 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid (CID 90672547) is 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid.
What is the SMILES notation for 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid?
The canonical SMILES for 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid is CCCCC[C@](C)(O)/C=C/C1CCC(=O)[C@@H]1CCCCOCC(=O)O.
What is the InChIKey of 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid?
The InChIKey is IXVUMDZQWOPTHA-ZDRSVHKKSA-N. The full InChI is InChI=1S/C20H34O5/c1-3-4-6-12-20(2,24)13-11-16-9-10-18(21)17(16)8-5-7-14-25-15-19(22)23/h11,13,16-17,24H,3-10,12,14-15H2,1-2H3,(H,22,23)/b13-11+/t16?,17-,20+/m1/s1.
What are the key properties of 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid?
2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid has a molecular weight of 354.49 g/mol, XLogP of 3.74, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1R)-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]-5-oxocyclopentyl]butoxy]acetic acid is sourced from PubChem (CID 90672547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).