About 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile
2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile (PubChem CID 90672670) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile |
| PubChem CID | 90672670 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile |
| SMILES | COc1cc(C2CC(CC#N)CN(C)C2)c(OC)cc1C |
| InChI | InChI=1S/C17H24N2O2/c1-12-7-17(21-4)15(9-16(12)20-3)14-8-13(5-6-18)10-19(2)11-14/h7,9,13-14H,5,8,10-11H2,1-4H3 |
| InChIKey | TXTHXGMNWBGCOS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile?
The IUPAC name of 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile (CID 90672670) is 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile.
What is the SMILES notation for 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile?
The canonical SMILES for 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile is COc1cc(C2CC(CC#N)CN(C)C2)c(OC)cc1C.
What is the InChIKey of 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile?
The InChIKey is TXTHXGMNWBGCOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-12-7-17(21-4)15(9-16(12)20-3)14-8-13(5-6-18)10-19(2)11-14/h7,9,13-14H,5,8,10-11H2,1-4H3.
What are the key properties of 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile?
2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile has a molecular weight of 288.39 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,5-dimethoxy-4-methylphenyl)-1-methylpiperidin-3-yl]acetonitrile is sourced from PubChem (CID 90672670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).