About butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid
butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid (PubChem CID 90672792) has the molecular formula C16H19Cl2N3O5S
and a molecular weight of 436.32 g/mol. Its IUPAC name is butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid.
Molecular Properties
| Compound Name | butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid |
| PubChem CID | 90672792 |
| Molecular Formula | C16H19Cl2N3O5S |
| Molecular Weight | 436.32 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid |
| SMILES | CCCCOC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C16H18Cl2N2O2S.HNO3/c1-2-3-8-22-16(21)23-15(10-20-7-6-19-11-20)13-5-4-12(17)9-14(13)18;2-1(3)4/h4-7,9,11,15H,2-3,8,10H2,1H3;(H,2,3,4) |
| InChIKey | KLDIOEUJQPAUFM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid?
The IUPAC name of butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid (CID 90672792) is butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid.
What is the SMILES notation for butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid?
The canonical SMILES for butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid is CCCCOC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O.
What is the InChIKey of butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid?
The InChIKey is KLDIOEUJQPAUFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O2S.HNO3/c1-2-3-8-22-16(21)23-15(10-20-7-6-19-11-20)13-5-4-12(17)9-14(13)18;2-1(3)4/h4-7,9,11,15H,2-3,8,10H2,1H3;(H,2,3,4).
What are the key properties of butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid?
butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid has a molecular weight of 436.32 g/mol, XLogP of 5.25, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for butyl [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylformate;nitric acid is sourced from PubChem (CID 90672792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).