About tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid
tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid (PubChem CID 90672793) has the molecular formula C16H19Cl2N3O4S2
and a molecular weight of 452.39 g/mol. Its IUPAC name is tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid.
Molecular Properties
| Compound Name | tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid |
| PubChem CID | 90672793 |
| Molecular Formula | C16H19Cl2N3O4S2 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid |
| SMILES | CC(C)(C)SC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C16H18Cl2N2OS2.HNO3/c1-16(2,3)23-15(21)22-14(9-20-7-6-19-10-20)12-5-4-11(17)8-13(12)18;2-1(3)4/h4-8,10,14H,9H2,1-3H3;(H,2,3,4) |
| InChIKey | VCXZHOSBWXSDSZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid?
The IUPAC name of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid (CID 90672793) is tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid.
What is the SMILES notation for tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid?
The canonical SMILES for tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid is CC(C)(C)SC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O.
What is the InChIKey of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid?
The InChIKey is VCXZHOSBWXSDSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2OS2.HNO3/c1-16(2,3)23-15(21)22-14(9-20-7-6-19-10-20)12-5-4-11(17)8-13(12)18;2-1(3)4/h4-8,10,14H,9H2,1-3H3;(H,2,3,4).
What are the key properties of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid?
tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid has a molecular weight of 452.39 g/mol, XLogP of 5.97, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone;nitric acid is sourced from PubChem (CID 90672793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).