About tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone
tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone (PubChem CID 90672794) has the molecular formula C16H18Cl2N2OS2
and a molecular weight of 389.37 g/mol. Its IUPAC name is tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone.
Molecular Properties
| Compound Name | tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone |
| PubChem CID | 90672794 |
| Molecular Formula | C16H18Cl2N2OS2 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone |
| SMILES | CC(C)(C)SC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2OS2/c1-16(2,3)23-15(21)22-14(9-20-7-6-19-10-20)12-5-4-11(17)8-13(12)18/h4-8,10,14H,9H2,1-3H3 |
| InChIKey | CJEPDVTVQXGCOC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone?
The IUPAC name of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone (CID 90672794) is tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone.
What is the SMILES notation for tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone?
The canonical SMILES for tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone is CC(C)(C)SC(=O)SC(Cn1ccnc1)c1ccc(Cl)cc1Cl.
What is the InChIKey of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone?
The InChIKey is CJEPDVTVQXGCOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2OS2/c1-16(2,3)23-15(21)22-14(9-20-7-6-19-10-20)12-5-4-11(17)8-13(12)18/h4-8,10,14H,9H2,1-3H3.
What are the key properties of tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone?
tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone has a molecular weight of 389.37 g/mol, XLogP of 6.32, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylsulfanyl-[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl]sulfanylmethanone is sourced from PubChem (CID 90672794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).