C12H21NaO7S — CID 90672914
sodium 6-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate (PubChem CID 90672914) has the molecular formula C12H21NaO7S and a molecular weight of 332.35 g/mol. Its IUPAC name is sodium 6-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate.
| Compound Name | sodium 6-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 90672914 |
| Molecular Formula | C12H21NaO7S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | sodium 6-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylhexanoate |
| SMILES | O=C([O-])CCCCCS[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C12H22O7S.Na/c13-6-7-9(16)10(17)11(18)12(19-7)20-5-3-1-2-4-8(14)15;/h7,9-13,16-18H,1-6H2,(H,14,15);/q;+1/p-1/t7-,9-,10+,11+,12-;/m1./s1 |
| InChIKey | PXGKDLYVIKDPAG-LCHHZQLVSA-M |
| XLogP | -5.17 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|