C14H21NO5S — CID 90672923
(2R,3S,4S,5S,6R)-2-[[4-(aminomethyl)phenyl]methylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 90672923) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[[4-(aminomethyl)phenyl]methylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[[4-(aminomethyl)phenyl]methylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90672923 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[[4-(aminomethyl)phenyl]methylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NCc1ccc(CS[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C14H21NO5S/c15-5-8-1-3-9(4-2-8)7-21-14-13(19)12(18)11(17)10(6-16)20-14/h1-4,10-14,16-19H,5-7,15H2/t10-,11-,12+,13+,14-/m1/s1 |
| InChIKey | MUNWZEYHHSCBQX-PEBLQZBPSA-N |
| XLogP | -0.82 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |