C13H19NO6 — CID 90672925
(2R,3S,4S,5S,6R)-2-[4-(aminomethyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 90672925) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2R,3S,4S,5S,6R)-2-[4-(aminomethyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6R)-2-[4-(aminomethyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90672925 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2R,3S,4S,5S,6R)-2-[4-(aminomethyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | NCc1ccc(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H19NO6/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-13,15-18H,5-6,14H2/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | ACYIXPATRLMHEU-BNDIWNMDSA-N |
| XLogP | -1.68 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |