C20H27NO2 — CID 90673029
(1R,9R,10S)-16-cyclobutyl-10,12-dimethyl-11-oxa-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol (PubChem CID 90673029) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (1R,9R,10S)-16-cyclobutyl-10,12-dimethyl-11-oxa-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol.
| Compound Name | (1R,9R,10S)-16-cyclobutyl-10,12-dimethyl-11-oxa-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 90673029 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (1R,9R,10S)-16-cyclobutyl-10,12-dimethyl-11-oxa-16-azatetracyclo[7.4.3.01,10.02,7]hexadeca-2(7),3,5-trien-4-ol |
| SMILES | CC1C[C@]23CCN(C4CCC4)[C@H](Cc4ccc(O)cc42)[C@@]3(C)O1 |
| InChI | InChI=1S/C20H27NO2/c1-13-12-20-8-9-21(15-4-3-5-15)18(19(20,2)23-13)10-14-6-7-16(22)11-17(14)20/h6-7,11,13,15,18,22H,3-5,8-10,12H2,1-2H3/t13?,18-,19-,20-/m1/s1 |
| InChIKey | PSAMIYWMKSUCJL-SCASHUABSA-N |
| XLogP | 3.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |