C10H8Cl2N4O2 — CID 90673045
3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid (PubChem CID 90673045) has the molecular formula C10H8Cl2N4O2 and a molecular weight of 287.11 g/mol. Its IUPAC name is 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid.
| Compound Name | 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 90673045 |
| Molecular Formula | C10H8Cl2N4O2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid |
| SMILES | O=C(O)CCn1nnc(-c2cc(Cl)cc(Cl)c2)n1 |
| InChI | InChI=1S/C10H8Cl2N4O2/c11-7-3-6(4-8(12)5-7)10-13-15-16(14-10)2-1-9(17)18/h3-5H,1-2H2,(H,17,18) |
| InChIKey | YMGWXPAFPWBSIZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |