3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid

C10H8Cl2N4O2 — CID 90673045

IUPAC3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid
SMILESO=C(O)CCn1nnc(-c2cc(Cl)cc(Cl)c2)n1
InChIInChI=1S/C10H8Cl2N4O2/c11-7-3-6(4-8(12)5-7)10-13-15-16(14-10)2-1-9(17)18/h3-5H,1-2H2,(H,17,18)
InChIKeyYMGWXPAFPWBSIZ-UHFFFAOYSA-N
MW287.11 g/mol
LogP2.12
Rot. Bonds4

About 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid

3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid (PubChem CID 90673045) has the molecular formula C10H8Cl2N4O2 and a molecular weight of 287.11 g/mol. Its IUPAC name is 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid.

Molecular Properties

Compound Name3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid
PubChem CID90673045
Molecular FormulaC10H8Cl2N4O2
Molecular Weight287.11 g/mol
Exact Mass286.00
IUPAC Name3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid
SMILESO=C(O)CCn1nnc(-c2cc(Cl)cc(Cl)c2)n1
InChIInChI=1S/C10H8Cl2N4O2/c11-7-3-6(4-8(12)5-7)10-13-15-16(14-10)2-1-9(17)18/h3-5H,1-2H2,(H,17,18)
InChIKeyYMGWXPAFPWBSIZ-UHFFFAOYSA-N
XLogP2.12
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.11
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid?
The IUPAC name of 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid (CID 90673045) is 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid.
What is the SMILES notation for 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid?
The canonical SMILES for 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid is O=C(O)CCn1nnc(-c2cc(Cl)cc(Cl)c2)n1.
What is the InChIKey of 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid?
The InChIKey is YMGWXPAFPWBSIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N4O2/c11-7-3-6(4-8(12)5-7)10-13-15-16(14-10)2-1-9(17)18/h3-5H,1-2H2,(H,17,18).
What are the key properties of 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid?
3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid has a molecular weight of 287.11 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3,5-dichlorophenyl)tetrazol-2-yl]propanoic acid is sourced from PubChem (CID 90673045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).