About 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid
7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid (PubChem CID 90673283) has the molecular formula C21H38O3
and a molecular weight of 338.53 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid.
Molecular Properties
| Compound Name | 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid |
| PubChem CID | 90673283 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid |
| SMILES | C=C1CC[C@H](CC[C@@H](O)CCCCC)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C21H38O3/c1-3-4-7-10-19(22)16-15-18-14-13-17(2)20(18)11-8-5-6-9-12-21(23)24/h18-20,22H,2-16H2,1H3,(H,23,24)/t18-,19+,20+/m1/s1 |
| InChIKey | MLUGZYYZIPYBNO-AABGKKOBSA-N |
| XLogP | 5.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid?
The IUPAC name of 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid (CID 90673283) is 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid.
What is the SMILES notation for 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid?
The canonical SMILES for 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid is C=C1CC[C@H](CC[C@@H](O)CCCCC)[C@H]1CCCCCCC(=O)O.
What is the InChIKey of 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid?
The InChIKey is MLUGZYYZIPYBNO-AABGKKOBSA-N. The full InChI is InChI=1S/C21H38O3/c1-3-4-7-10-19(22)16-15-18-14-13-17(2)20(18)11-8-5-6-9-12-21(23)24/h18-20,22H,2-16H2,1H3,(H,23,24)/t18-,19+,20+/m1/s1.
What are the key properties of 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid?
7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid has a molecular weight of 338.53 g/mol, XLogP of 5.72, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1R,2R)-2-[(3S)-3-hydroxyoctyl]-5-methylidenecyclopentyl]heptanoic acid is sourced from PubChem (CID 90673283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).