C14H21N3O4S — CID 90673318
(E)-N-[(2S)-1-hydroxy-3-propylsulfanylpropan-2-yl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide (PubChem CID 90673318) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is (E)-N-[(2S)-1-hydroxy-3-propylsulfanylpropan-2-yl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2S)-1-hydroxy-3-propylsulfanylpropan-2-yl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 90673318 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (E)-N-[(2S)-1-hydroxy-3-propylsulfanylpropan-2-yl]-3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
| SMILES | CCCSC[C@H](CO)NC(=O)/C=C/c1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H21N3O4S/c1-3-6-22-8-10(7-18)16-12(19)5-4-11-9(2)15-14(21)17-13(11)20/h4-5,10,18H,3,6-8H2,1-2H3,(H,16,19)(H2,15,17,20,21)/b5-4+/t10-/m0/s1 |
| InChIKey | JWLKSXNQUFIINT-YEZKRMTDSA-N |
| XLogP | 0.01 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|