About 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide
1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide (PubChem CID 90673370) has the molecular formula C16H21BrClNO
and a molecular weight of 358.71 g/mol. Its IUPAC name is 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide.
Molecular Properties
| Compound Name | 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide |
| PubChem CID | 90673370 |
| Molecular Formula | C16H21BrClNO |
| Molecular Weight | 358.71 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide |
| SMILES | Br.COc1ccc(Cl)c2c1CCC(CN1CCCC1)=C2 |
| InChI | InChI=1S/C16H20ClNO.BrH/c1-19-16-7-6-15(17)14-10-12(4-5-13(14)16)11-18-8-2-3-9-18;/h6-7,10H,2-5,8-9,11H2,1H3;1H |
| InChIKey | BJVWNNDGSZQQSV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.71 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide?
The IUPAC name of 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide (CID 90673370) is 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide.
What is the SMILES notation for 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide?
The canonical SMILES for 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide is Br.COc1ccc(Cl)c2c1CCC(CN1CCCC1)=C2.
What is the InChIKey of 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide?
The InChIKey is BJVWNNDGSZQQSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClNO.BrH/c1-19-16-7-6-15(17)14-10-12(4-5-13(14)16)11-18-8-2-3-9-18;/h6-7,10H,2-5,8-9,11H2,1H3;1H.
What are the key properties of 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide?
1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide has a molecular weight of 358.71 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(8-chloro-5-methoxy-3,4-dihydronaphthalen-2-yl)methyl]pyrrolidine;hydrobromide is sourced from PubChem (CID 90673370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).