About 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride
6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride (PubChem CID 90673544) has the molecular formula C21H22Cl2N2S
and a molecular weight of 405.39 g/mol. Its IUPAC name is 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride |
| PubChem CID | 90673544 |
| Molecular Formula | C21H22Cl2N2S |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride |
| SMILES | Cl.Clc1ccc2sc(-c3ccccc3)c/c(=N\CCN3CCCC3)c2c1 |
| InChI | InChI=1S/C21H21ClN2S.ClH/c22-17-8-9-20-18(14-17)19(23-10-13-24-11-4-5-12-24)15-21(25-20)16-6-2-1-3-7-16;/h1-3,6-9,14-15H,4-5,10-13H2;1H/b23-19+; |
| InChIKey | KXTVJJXCEUCCLO-IMPZXOFZSA-N |
| XLogP | 5.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride?
The IUPAC name of 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride (CID 90673544) is 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride.
What is the SMILES notation for 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride?
The canonical SMILES for 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride is Cl.Clc1ccc2sc(-c3ccccc3)c/c(=N\CCN3CCCC3)c2c1.
What is the InChIKey of 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride?
The InChIKey is KXTVJJXCEUCCLO-IMPZXOFZSA-N. The full InChI is InChI=1S/C21H21ClN2S.ClH/c22-17-8-9-20-18(14-17)19(23-10-13-24-11-4-5-12-24)15-21(25-20)16-6-2-1-3-7-16;/h1-3,6-9,14-15H,4-5,10-13H2;1H/b23-19+;.
What are the key properties of 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride?
6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride has a molecular weight of 405.39 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-phenyl-N-(2-pyrrolidin-1-ylethyl)thiochromen-4-imine;hydrochloride is sourced from PubChem (CID 90673544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).