C21H29FO2 — CID 90673581
methyl (2E,4E,6Z,8E)-6-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 90673581) has the molecular formula C21H29FO2 and a molecular weight of 332.46 g/mol. Its IUPAC name is methyl (2E,4E,6Z,8E)-6-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6Z,8E)-6-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 90673581 |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | methyl (2E,4E,6Z,8E)-6-fluoro-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | COC(=O)/C=C(C)/C=C/C(F)=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C21H29FO2/c1-15(14-20(23)24-6)9-12-19(22)17(3)10-11-18-16(2)8-7-13-21(18,4)5/h9-12,14H,7-8,13H2,1-6H3/b11-10+,12-9+,15-14+,19-17- |
| InChIKey | MEIAWAWSYIBSKH-PVKAPKHISA-N |
| XLogP | 5.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|