C20H34O5 — CID 90673601
methyl 7-[(3R,4R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxooxolan-3-yl]heptanoate (PubChem CID 90673601) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is methyl 7-[(3R,4R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxooxolan-3-yl]heptanoate.
| Compound Name | methyl 7-[(3R,4R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxooxolan-3-yl]heptanoate |
|---|---|
| PubChem CID | 90673601 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | methyl 7-[(3R,4R)-4-[(E,3S)-3-hydroxyoct-1-enyl]-2-oxooxolan-3-yl]heptanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1COC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C20H34O5/c1-3-4-7-10-17(21)14-13-16-15-25-20(23)18(16)11-8-5-6-9-12-19(22)24-2/h13-14,16-18,21H,3-12,15H2,1-2H3/b14-13+/t16-,17-,18+/m0/s1 |
| InChIKey | QKIWIMOLPKYATQ-YUDUXVMTSA-N |
| XLogP | 3.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|