C20H38O5 — CID 90673605
methyl (E,8R,9R,12S)-12-hydroxy-8,9-bis(hydroxymethyl)heptadec-10-enoate (PubChem CID 90673605) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is methyl (E,8R,9R,12S)-12-hydroxy-8,9-bis(hydroxymethyl)heptadec-10-enoate.
| Compound Name | methyl (E,8R,9R,12S)-12-hydroxy-8,9-bis(hydroxymethyl)heptadec-10-enoate |
|---|---|
| PubChem CID | 90673605 |
| Molecular Formula | C20H38O5 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | methyl (E,8R,9R,12S)-12-hydroxy-8,9-bis(hydroxymethyl)heptadec-10-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H](CO)[C@H](CO)CCCCCCC(=O)OC |
| InChI | InChI=1S/C20H38O5/c1-3-4-7-11-19(23)14-13-18(16-22)17(15-21)10-8-5-6-9-12-20(24)25-2/h13-14,17-19,21-23H,3-12,15-16H2,1-2H3/b14-13+/t17-,18-,19-/m0/s1 |
| InChIKey | OBFQFOMLAWYXGC-SNLJXXQOSA-N |
| XLogP | 3.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|