C25H27F3NO4PS — CID 90673678
1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine;phosphoric acid (PubChem CID 90673678) has the molecular formula C25H27F3NO4PS and a molecular weight of 525.53 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine;phosphoric acid.
| Compound Name | 1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine;phosphoric acid |
|---|---|
| PubChem CID | 90673678 |
| Molecular Formula | C25H27F3NO4PS |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine;phosphoric acid |
| SMILES | FC(F)(F)Sc1ccc2c(c1)C(=C1CCN(CC3CC3)CC1)c1ccccc1C=C2.O=P(O)(O)O |
| InChI | InChI=1S/C25H24F3NS.H3O4P/c26-25(27,28)30-21-10-9-19-8-7-18-3-1-2-4-22(18)24(23(19)15-21)20-11-13-29(14-12-20)16-17-5-6-17;1-5(2,3)4/h1-4,7-10,15,17H,5-6,11-14,16H2;(H3,1,2,3,4) |
| InChIKey | CGHKIONOVHRUHF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|