C21H25NO3S — CID 90673765
[(13S)-10,13-dimethyl-1-phenyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] methanesulfonate (PubChem CID 90673765) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is [(13S)-10,13-dimethyl-1-phenyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] methanesulfonate.
| Compound Name | [(13S)-10,13-dimethyl-1-phenyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 90673765 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | [(13S)-10,13-dimethyl-1-phenyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-yl] methanesulfonate |
| SMILES | C[C@@H]1C2Cc3ccc(OS(C)(=O)=O)cc3C1(c1ccccc1)CCN2C |
| InChI | InChI=1S/C21H25NO3S/c1-15-20-13-16-9-10-18(25-26(3,23)24)14-19(16)21(15,11-12-22(20)2)17-7-5-4-6-8-17/h4-10,14-15,20H,11-13H2,1-3H3/t15-,20?,21?/m1/s1 |
| InChIKey | VYRZALCMYOYOAY-TVRCVXMWSA-N |
| XLogP | 3.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|