C15H13NO — CID 90673791
(1,2,3,4,5,6-14C6)cyclohexatrienyl(2,3-dihydro-1H-indol-7-yl)methanone (PubChem CID 90673791) has the molecular formula C15H13NO and a molecular weight of 235.23 g/mol. Its IUPAC name is (1,2,3,4,5,6-14C6)cyclohexatrienyl(2,3-dihydro-1H-indol-7-yl)methanone.
| Compound Name | (1,2,3,4,5,6-14C6)cyclohexatrienyl(2,3-dihydro-1H-indol-7-yl)methanone |
|---|---|
| PubChem CID | 90673791 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (1,2,3,4,5,6-14C6)cyclohexatrienyl(2,3-dihydro-1H-indol-7-yl)methanone |
| SMILES | O=C(c1cccc2c1NCC2)[14c]1[14cH][14cH][14cH][14cH][14cH]1 |
| InChI | InChI=1S/C15H13NO/c17-15(12-5-2-1-3-6-12)13-8-4-7-11-9-10-16-14(11)13/h1-8,16H,9-10H2/i1+2,2+2,3+2,5+2,6+2,12+2 |
| InChIKey | ZZOVZJBWXVZVLN-KUHMKJAJSA-N |
| XLogP | 2.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|