About 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide
9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide (PubChem CID 90673824) has the molecular formula C14H14INO2
and a molecular weight of 355.18 g/mol. Its IUPAC name is 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide.
Molecular Properties
| Compound Name | 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide |
| PubChem CID | 90673824 |
| Molecular Formula | C14H14INO2 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide |
| SMILES | I.NC1Cc2cc(O)c(O)cc2-c2ccccc21 |
| InChI | InChI=1S/C14H13NO2.HI/c15-12-5-8-6-13(16)14(17)7-11(8)9-3-1-2-4-10(9)12;/h1-4,6-7,12,16-17H,5,15H2;1H |
| InChIKey | FMNXLJAJIQZXPU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide?
The IUPAC name of 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide (CID 90673824) is 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide.
What is the SMILES notation for 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide?
The canonical SMILES for 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide is I.NC1Cc2cc(O)c(O)cc2-c2ccccc21.
What is the InChIKey of 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide?
The InChIKey is FMNXLJAJIQZXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2.HI/c15-12-5-8-6-13(16)14(17)7-11(8)9-3-1-2-4-10(9)12;/h1-4,6-7,12,16-17H,5,15H2;1H.
What are the key properties of 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide?
9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide has a molecular weight of 355.18 g/mol, XLogP of 2.94, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-9,10-dihydrophenanthrene-2,3-diol;hydroiodide is sourced from PubChem (CID 90673824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).