About 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride
2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride (PubChem CID 90673829) has the molecular formula C32H35ClN8
and a molecular weight of 567.14 g/mol. Its IUPAC name is 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride.
Molecular Properties
| Compound Name | 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride |
| PubChem CID | 90673829 |
| Molecular Formula | C32H35ClN8 |
| Molecular Weight | 567.14 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride |
| SMILES | Cl.c1ccc(N2CCN(Cc3ccc4nc5ccc(CN6CCN(c7ccccn7)CC6)cc5nc4c3)CC2)nc1 |
| InChI | InChI=1S/C32H34N8.ClH/c1-3-11-33-31(5-1)39-17-13-37(14-18-39)23-25-7-9-27-29(21-25)36-30-22-26(8-10-28(30)35-27)24-38-15-19-40(20-16-38)32-6-2-4-12-34-32;/h1-12,21-22H,13-20,23-24H2;1H |
| InChIKey | JXFBZPXSDXNOPS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 567.14 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride?
The IUPAC name of 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride (CID 90673829) is 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride.
What is the SMILES notation for 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride?
The canonical SMILES for 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride is Cl.c1ccc(N2CCN(Cc3ccc4nc5ccc(CN6CCN(c7ccccn7)CC6)cc5nc4c3)CC2)nc1.
What is the InChIKey of 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride?
The InChIKey is JXFBZPXSDXNOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H34N8.ClH/c1-3-11-33-31(5-1)39-17-13-37(14-18-39)23-25-7-9-27-29(21-25)36-30-22-26(8-10-28(30)35-27)24-38-15-19-40(20-16-38)32-6-2-4-12-34-32;/h1-12,21-22H,13-20,23-24H2;1H.
What are the key properties of 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride?
2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride has a molecular weight of 567.14 g/mol, XLogP of 4.64, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8-bis[(4-pyridin-2-ylpiperazin-1-yl)methyl]phenazine;hydrochloride is sourced from PubChem (CID 90673829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).