C23H21ClN2O3 — CID 90673838
3-[4-[(4-methylacridin-9-yl)amino]phenoxy]propanoic acid;hydrochloride (PubChem CID 90673838) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is 3-[4-[(4-methylacridin-9-yl)amino]phenoxy]propanoic acid;hydrochloride.
| Compound Name | 3-[4-[(4-methylacridin-9-yl)amino]phenoxy]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 90673838 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3-[4-[(4-methylacridin-9-yl)amino]phenoxy]propanoic acid;hydrochloride |
| SMILES | Cc1cccc2c(Nc3ccc(OCCC(=O)O)cc3)c3ccccc3nc12.Cl |
| InChI | InChI=1S/C23H20N2O3.ClH/c1-15-5-4-7-19-22(15)25-20-8-3-2-6-18(20)23(19)24-16-9-11-17(12-10-16)28-14-13-21(26)27;/h2-12H,13-14H2,1H3,(H,24,25)(H,26,27);1H |
| InChIKey | QEZPTQXVWIYIIA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|