C23H40O5 — CID 90673937
methyl 7-[(1R,2R,3R)-2-[(E)-4-ethyl-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoate (PubChem CID 90673937) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R)-2-[(E)-4-ethyl-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R)-2-[(E)-4-ethyl-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 90673937 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | methyl 7-[(1R,2R,3R)-2-[(E)-4-ethyl-4-hydroxyoct-1-enyl]-3-hydroxy-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCC(O)(CC)C/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H40O5/c1-4-6-15-23(27,5-2)16-11-13-19-18(20(24)17-21(19)25)12-9-7-8-10-14-22(26)28-3/h11,13,18-19,21,25,27H,4-10,12,14-17H2,1-3H3/b13-11+/t18-,19-,21-,23?/m1/s1 |
| InChIKey | ONTLADLDFHCNTE-PYWWEAFGSA-N |
| XLogP | 4.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|