About 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride
2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride (PubChem CID 90674130) has the molecular formula C16H27ClN2O2
and a molecular weight of 314.86 g/mol. Its IUPAC name is 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride |
| PubChem CID | 90674130 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride |
| SMILES | CCCCOc1cc(C)c(N(C)C(=O)C(C)N)c(C)c1.Cl |
| InChI | InChI=1S/C16H26N2O2.ClH/c1-6-7-8-20-14-9-11(2)15(12(3)10-14)18(5)16(19)13(4)17;/h9-10,13H,6-8,17H2,1-5H3;1H |
| InChIKey | ZVLNYVAWFNUHJI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride?
The IUPAC name of 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride (CID 90674130) is 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride.
What is the SMILES notation for 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride?
The canonical SMILES for 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride is CCCCOc1cc(C)c(N(C)C(=O)C(C)N)c(C)c1.Cl.
What is the InChIKey of 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride?
The InChIKey is ZVLNYVAWFNUHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2.ClH/c1-6-7-8-20-14-9-11(2)15(12(3)10-14)18(5)16(19)13(4)17;/h9-10,13H,6-8,17H2,1-5H3;1H.
What are the key properties of 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride?
2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride has a molecular weight of 314.86 g/mol, XLogP of 3.21, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(4-butoxy-2,6-dimethylphenyl)-N-methylpropanamide;hydrochloride is sourced from PubChem (CID 90674130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).