C23H38O6 — CID 90674141
methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]hept-5-enoate (PubChem CID 90674141) has the molecular formula C23H38O6 and a molecular weight of 410.55 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90674141 |
| Molecular Formula | C23H38O6 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]2O)OCCO1 |
| InChI | InChI=1S/C23H38O6/c1-3-4-9-13-23(28-15-16-29-23)14-12-19-18(20(24)17-21(19)25)10-7-5-6-8-11-22(26)27-2/h5,7,12,14,18-21,24-25H,3-4,6,8-11,13,15-17H2,1-2H3/b7-5-,14-12+/t18-,19-,20+,21-/m1/s1 |
| InChIKey | LHWGYEFMSTYDKY-LCNNQNNXSA-N |
| XLogP | 3.51 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|