C24H40O6 — CID 90674142
methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxan-2-yl)ethenyl]cyclopentyl]hept-5-enoate (PubChem CID 90674142) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxan-2-yl)ethenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxan-2-yl)ethenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90674142 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-(2-pentyl-1,3-dioxan-2-yl)ethenyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(/C=C/[C@@H]2[C@@H](C/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]2O)OCCCO1 |
| InChI | InChI=1S/C24H40O6/c1-3-4-9-14-24(29-16-10-17-30-24)15-13-20-19(21(25)18-22(20)26)11-7-5-6-8-12-23(27)28-2/h5,7,13,15,19-22,25-26H,3-4,6,8-12,14,16-18H2,1-2H3/b7-5-,15-13+/t19-,20-,21+,22-/m1/s1 |
| InChIKey | LXMUKVBYKRANAZ-LGXYEVNDSA-N |
| XLogP | 3.90 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|